C5H20N8 — CID 152759795
[2-[(2,2-dimethylhydrazinyl)-[2-(methylamino)hydrazinyl]amino]hydrazinyl]ethane (PubChem CID 152759795) has the molecular formula C5H20N8 and a molecular weight of 192.27 g/mol. Its IUPAC name is [2-[(2,2-dimethylhydrazinyl)-[2-(methylamino)hydrazinyl]amino]hydrazinyl]ethane.
| Compound Name | [2-[(2,2-dimethylhydrazinyl)-[2-(methylamino)hydrazinyl]amino]hydrazinyl]ethane |
|---|---|
| PubChem CID | 152759795 |
| Molecular Formula | C5H20N8 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.18 |
| IUPAC Name | [2-[(2,2-dimethylhydrazinyl)-[2-(methylamino)hydrazinyl]amino]hydrazinyl]ethane |
| SMILES | CCNNN(NNNC)NN(C)C |
| InChI | InChI=1S/C5H20N8/c1-5-7-9-13(10-8-6-2)11-12(3)4/h6-11H,5H2,1-4H3 |
| InChIKey | RBVJYBZVYOGEOK-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|