C6H12N2O4-2 — CID 21123352
1,2-diethylhydrazine;oxalate (PubChem CID 21123352) has the molecular formula C6H12N2O4-2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1,2-diethylhydrazine;oxalate.
| Compound Name | 1,2-diethylhydrazine;oxalate |
|---|---|
| PubChem CID | 21123352 |
| Molecular Formula | C6H12N2O4-2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1,2-diethylhydrazine;oxalate |
| SMILES | CCNNCC.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C4H12N2.C2H2O4/c1-3-5-6-4-2;3-1(4)2(5)6/h5-6H,3-4H2,1-2H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | JOBGVZRSJKIHFL-UHFFFAOYSA-L |
| XLogP | -3.39 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|