C10H28N4 — CID 134227304
2-ethyl-1,1-dimethylhydrazine;1,1,2-triethylhydrazine (PubChem CID 134227304) has the molecular formula C10H28N4 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-ethyl-1,1-dimethylhydrazine;1,1,2-triethylhydrazine.
| Compound Name | 2-ethyl-1,1-dimethylhydrazine;1,1,2-triethylhydrazine |
|---|---|
| PubChem CID | 134227304 |
| Molecular Formula | C10H28N4 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.23 |
| IUPAC Name | 2-ethyl-1,1-dimethylhydrazine;1,1,2-triethylhydrazine |
| SMILES | CCNN(C)C.CCNN(CC)CC |
| InChI | InChI=1S/C6H16N2.C4H12N2/c1-4-7-8(5-2)6-3;1-4-5-6(2)3/h7H,4-6H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | QQUSCCXIAZUFLO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|