C11H10F5N3O — CID 146437908
4-(3,3-difluoroazetidin-1-yl)-3-(trifluoromethyl)benzohydrazide (PubChem CID 146437908) has the molecular formula C11H10F5N3O and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-(3,3-difluoroazetidin-1-yl)-3-(trifluoromethyl)benzohydrazide.
| Compound Name | 4-(3,3-difluoroazetidin-1-yl)-3-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 146437908 |
| Molecular Formula | C11H10F5N3O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-(3,3-difluoroazetidin-1-yl)-3-(trifluoromethyl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(N2CC(F)(F)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F5N3O/c12-10(13)4-19(5-10)8-2-1-6(9(20)18-17)3-7(8)11(14,15)16/h1-3H,4-5,17H2,(H,18,20) |
| InChIKey | YDDGMRMZNZQRHU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|