C30H44N6O2S2 — CID 146442444
2,5-bis[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]benzene-1,4-diol (PubChem CID 146442444) has the molecular formula C30H44N6O2S2 and a molecular weight of 584.86 g/mol. Its IUPAC name is 2,5-bis[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]benzene-1,4-diol.
| Compound Name | 2,5-bis[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 146442444 |
| Molecular Formula | C30H44N6O2S2 |
| Molecular Weight | 584.86 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 2,5-bis[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]benzene-1,4-diol |
| SMILES | CCCN(CCc1cc(O)c(CCN(CCC)C2CCc3nc(N)sc3C2)cc1O)C1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C30H44N6O2S2/c1-3-11-35(21-5-7-23-27(17-21)39-29(31)33-23)13-9-19-15-26(38)20(16-25(19)37)10-14-36(12-4-2)22-6-8-24-28(18-22)40-30(32)34-24/h15-16,21-22,37-38H,3-14,17-18H2,1-2H3,(H2,31,33)(H2,32,34) |
| InChIKey | WLQPRUMGPAOCRW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|