C31H45N5O2S2 — CID 167007197
2-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]-5-[2-[(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-6-yl)-propylamino]ethyl]benzene-1,4-diol (PubChem CID 167007197) has the molecular formula C31H45N5O2S2 and a molecular weight of 583.87 g/mol. Its IUPAC name is 2-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]-5-[2-[(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-6-yl)-propylamino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]-5-[2-[(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-6-yl)-propylamino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 167007197 |
| Molecular Formula | C31H45N5O2S2 |
| Molecular Weight | 583.87 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | 2-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]-5-[2-[(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-6-yl)-propylamino]ethyl]benzene-1,4-diol |
| SMILES | CCCN(CCc1cc(O)c(CCN(CCC)[C@H]2CCc3nc(N)sc3C2)cc1O)C1CCc2cc(N)sc2C1 |
| InChI | InChI=1S/C31H45N5O2S2/c1-3-11-35(23-6-5-22-17-30(32)39-28(22)18-23)13-9-20-15-27(38)21(16-26(20)37)10-14-36(12-4-2)24-7-8-25-29(19-24)40-31(33)34-25/h15-17,23-24,37-38H,3-14,18-19,32H2,1-2H3,(H2,33,34)/t23?,24-/m0/s1 |
| InChIKey | SVOYSKKBSDGZHO-CGAIIQECSA-N |
| XLogP | 5.40 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|