C22H31Cl2N5S — CID 24866454
(6S)-6-N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 24866454) has the molecular formula C22H31Cl2N5S and a molecular weight of 468.50 g/mol. Its IUPAC name is (6S)-6-N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | (6S)-6-N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 24866454 |
| Molecular Formula | C22H31Cl2N5S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (6S)-6-N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCN(CCN1CCN(c2cccc(Cl)c2Cl)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C22H31Cl2N5S/c1-2-8-28(16-6-7-18-20(15-16)30-22(25)26-18)12-9-27-10-13-29(14-11-27)19-5-3-4-17(23)21(19)24/h3-5,16H,2,6-15H2,1H3,(H2,25,26)/t16-/m0/s1 |
| InChIKey | MTSRJJUOIYINNP-INIZCTEOSA-N |
| XLogP | 4.42 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |