C21H17F6N5O — CID 146480809
[2-methyl-5-(trifluoromethyl)-1H-imidazol-4-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 146480809) has the molecular formula C21H17F6N5O and a molecular weight of 469.39 g/mol. Its IUPAC name is [2-methyl-5-(trifluoromethyl)-1H-imidazol-4-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | [2-methyl-5-(trifluoromethyl)-1H-imidazol-4-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 146480809 |
| Molecular Formula | C21H17F6N5O |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [2-methyl-5-(trifluoromethyl)-1H-imidazol-4-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | Cc1nc(C(=O)N2[C@H]3CC[C@@H]2c2nn(C)c(-c4cc(F)c(F)c(F)c4)c2C3)c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C21H17F6N5O/c1-8-28-17(19(29-8)21(25,26)27)20(33)32-10-3-4-14(32)16-11(7-10)18(31(2)30-16)9-5-12(22)15(24)13(23)6-9/h5-6,10,14H,3-4,7H2,1-2H3,(H,28,29)/t10-,14+/m0/s1 |
| InChIKey | CXNYSBKNNUZRDA-IINYFYTJSA-N |
| XLogP | 4.46 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|