C17H15ClF2N2O — CID 146496063
1-but-3-enyl-3-chloro-N-(3,4-difluorophenyl)-5-ethenylpyrrole-2-carboxamide (PubChem CID 146496063) has the molecular formula C17H15ClF2N2O and a molecular weight of 336.77 g/mol. Its IUPAC name is 1-but-3-enyl-3-chloro-N-(3,4-difluorophenyl)-5-ethenylpyrrole-2-carboxamide.
| Compound Name | 1-but-3-enyl-3-chloro-N-(3,4-difluorophenyl)-5-ethenylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146496063 |
| Molecular Formula | C17H15ClF2N2O |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-but-3-enyl-3-chloro-N-(3,4-difluorophenyl)-5-ethenylpyrrole-2-carboxamide |
| SMILES | C=CCCn1c(C=C)cc(Cl)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15ClF2N2O/c1-3-5-8-22-12(4-2)10-13(18)16(22)17(23)21-11-6-7-14(19)15(20)9-11/h3-4,6-7,9-10H,1-2,5,8H2,(H,21,23) |
| InChIKey | SHDJJFCSFHHDMX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|