C17H12FN5O2 — CID 146507974
3-cyano-2-(3-cyano-2-fluorophenyl)-6-hydroxy-N-(N'-methylcarbamimidoyl)benzamide (PubChem CID 146507974) has the molecular formula C17H12FN5O2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 3-cyano-2-(3-cyano-2-fluorophenyl)-6-hydroxy-N-(N'-methylcarbamimidoyl)benzamide.
| Compound Name | 3-cyano-2-(3-cyano-2-fluorophenyl)-6-hydroxy-N-(N'-methylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 146507974 |
| Molecular Formula | C17H12FN5O2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-cyano-2-(3-cyano-2-fluorophenyl)-6-hydroxy-N-(N'-methylcarbamimidoyl)benzamide |
| SMILES | C/N=C(\N)NC(=O)c1c(O)ccc(C#N)c1-c1cccc(C#N)c1F |
| InChI | InChI=1S/C17H12FN5O2/c1-22-17(21)23-16(25)14-12(24)6-5-9(7-19)13(14)11-4-2-3-10(8-20)15(11)18/h2-6,24H,1H3,(H3,21,22,23,25) |
| InChIKey | JTSIJBUBEDQSKL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|