C26H31ClN2O4S — CID 14651601
ethyl 6-chloro-2-[(3-methoxyphenyl)methyl]-3-oxo-4-(2-piperidin-1-ylethyl)-1,4-benzothiazine-2-carboxylate (PubChem CID 14651601) has the molecular formula C26H31ClN2O4S and a molecular weight of 503.06 g/mol. Its IUPAC name is ethyl 6-chloro-2-[(3-methoxyphenyl)methyl]-3-oxo-4-(2-piperidin-1-ylethyl)-1,4-benzothiazine-2-carboxylate.
| Compound Name | ethyl 6-chloro-2-[(3-methoxyphenyl)methyl]-3-oxo-4-(2-piperidin-1-ylethyl)-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 14651601 |
| Molecular Formula | C26H31ClN2O4S |
| Molecular Weight | 503.06 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | ethyl 6-chloro-2-[(3-methoxyphenyl)methyl]-3-oxo-4-(2-piperidin-1-ylethyl)-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2cccc(OC)c2)Sc2ccc(Cl)cc2N(CCN2CCCCC2)C1=O |
| InChI | InChI=1S/C26H31ClN2O4S/c1-3-33-25(31)26(18-19-8-7-9-21(16-19)32-2)24(30)29(15-14-28-12-5-4-6-13-28)22-17-20(27)10-11-23(22)34-26/h7-11,16-17H,3-6,12-15,18H2,1-2H3 |
| InChIKey | OSSVOUXRMQALHE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.06 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|