C25H27F3N2O3S — CID 139757067
methyl 3-oxo-4-(2-piperidin-1-ylethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazine-2-carboxylate (PubChem CID 139757067) has the molecular formula C25H27F3N2O3S and a molecular weight of 492.56 g/mol. Its IUPAC name is methyl 3-oxo-4-(2-piperidin-1-ylethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 3-oxo-4-(2-piperidin-1-ylethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 139757067 |
| Molecular Formula | C25H27F3N2O3S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | methyl 3-oxo-4-(2-piperidin-1-ylethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1(Cc2cccc(C(F)(F)F)c2)Sc2ccccc2N(CCN2CCCCC2)C1=O |
| InChI | InChI=1S/C25H27F3N2O3S/c1-33-23(32)24(17-18-8-7-9-19(16-18)25(26,27)28)22(31)30(15-14-29-12-5-2-6-13-29)20-10-3-4-11-21(20)34-24/h3-4,7-11,16H,2,5-6,12-15,17H2,1H3 |
| InChIKey | ZDYPHDYCBLPQAM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|