C15H15ClN4O — CID 146516050
N-[2-[(5-chloro-2-methylpyrimidin-4-yl)amino]phenyl]-N-methylprop-2-enamide (PubChem CID 146516050) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-methylpyrimidin-4-yl)amino]phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[(5-chloro-2-methylpyrimidin-4-yl)amino]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 146516050 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-[(5-chloro-2-methylpyrimidin-4-yl)amino]phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccccc1Nc1nc(C)ncc1Cl |
| InChI | InChI=1S/C15H15ClN4O/c1-4-14(21)20(3)13-8-6-5-7-12(13)19-15-11(16)9-17-10(2)18-15/h4-9H,1H2,2-3H3,(H,17,18,19) |
| InChIKey | FFFIRDKTHPIFGB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|