C8H11N5O2S — CID 146529797
(2E,4E)-5-(methylideneamino)-5-(triazol-1-yl)penta-2,4-diene-2-sulfonamide (PubChem CID 146529797) has the molecular formula C8H11N5O2S and a molecular weight of 241.28 g/mol. Its IUPAC name is (2E,4E)-5-(methylideneamino)-5-(triazol-1-yl)penta-2,4-diene-2-sulfonamide.
| Compound Name | (2E,4E)-5-(methylideneamino)-5-(triazol-1-yl)penta-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 146529797 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (2E,4E)-5-(methylideneamino)-5-(triazol-1-yl)penta-2,4-diene-2-sulfonamide |
| SMILES | C=N/C(=C\C=C(/C)S(N)(=O)=O)n1ccnn1 |
| InChI | InChI=1S/C8H11N5O2S/c1-7(16(9,14)15)3-4-8(10-2)13-6-5-11-12-13/h3-6H,2H2,1H3,(H2,9,14,15)/b7-3+,8-4+ |
| InChIKey | LVNJTSXVEUJGAZ-FCXRPNKRSA-N |
| XLogP | -0.03 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|