C11H13F3N4S — CID 138660935
(1E,3E,5E)-2-methylsulfanyl-5-(triazol-1-yl)-4-(trifluoromethyl)hepta-1,3,5-trien-1-amine (PubChem CID 138660935) has the molecular formula C11H13F3N4S and a molecular weight of 290.31 g/mol. Its IUPAC name is (1E,3E,5E)-2-methylsulfanyl-5-(triazol-1-yl)-4-(trifluoromethyl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3E,5E)-2-methylsulfanyl-5-(triazol-1-yl)-4-(trifluoromethyl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 138660935 |
| Molecular Formula | C11H13F3N4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (1E,3E,5E)-2-methylsulfanyl-5-(triazol-1-yl)-4-(trifluoromethyl)hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(C(=C/C(=C\N)SC)\C(F)(F)F)/n1ccnn1 |
| InChI | InChI=1S/C11H13F3N4S/c1-3-10(18-5-4-16-17-18)9(11(12,13)14)6-8(7-15)19-2/h3-7H,15H2,1-2H3/b8-7+,9-6+,10-3+ |
| InChIKey | FTRNZTXZCHBHAU-SXDDYREGSA-N |
| XLogP | 2.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|