C21H22N4OS2 — CID 146533146
1-[3-(2-methoxybenzenecarboximidoyl)-4,5-dimethylthiophen-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 146533146) has the molecular formula C21H22N4OS2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 1-[3-(2-methoxybenzenecarboximidoyl)-4,5-dimethylthiophen-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[3-(2-methoxybenzenecarboximidoyl)-4,5-dimethylthiophen-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 146533146 |
| Molecular Formula | C21H22N4OS2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[3-(2-methoxybenzenecarboximidoyl)-4,5-dimethylthiophen-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | [H]/N=C(/c1ccccc1OC)c1c(NC(=S)NCc2cccnc2)sc(C)c1C |
| InChI | InChI=1S/C21H22N4OS2/c1-13-14(2)28-20(25-21(27)24-12-15-7-6-10-23-11-15)18(13)19(22)16-8-4-5-9-17(16)26-3/h4-11,22H,12H2,1-3H3,(H2,24,25,27)/b22-19- |
| InChIKey | ZDXLMTCUBPPDPB-QOCHGBHMSA-N |
| XLogP | 4.67 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|