About S-(cyanomethyl) 2-fluorobenzenecarbothioate
S-(cyanomethyl) 2-fluorobenzenecarbothioate (PubChem CID 146534654) has the molecular formula C9H6FNOS
and a molecular weight of 195.22 g/mol. Its IUPAC name is S-(cyanomethyl) 2-fluorobenzenecarbothioate.
Molecular Properties
| Compound Name | S-(cyanomethyl) 2-fluorobenzenecarbothioate |
| PubChem CID | 146534654 |
| Molecular Formula | C9H6FNOS |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | S-(cyanomethyl) 2-fluorobenzenecarbothioate |
| SMILES | N#CCSC(=O)c1ccccc1F |
| InChI | InChI=1S/C9H6FNOS/c10-8-4-2-1-3-7(8)9(12)13-6-5-11/h1-4H,6H2 |
| InChIKey | MCABVAFIVUKINT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(cyanomethyl) 2-fluorobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(cyanomethyl) 2-fluorobenzenecarbothioate?
The IUPAC name of S-(cyanomethyl) 2-fluorobenzenecarbothioate (CID 146534654) is S-(cyanomethyl) 2-fluorobenzenecarbothioate.
What is the SMILES notation for S-(cyanomethyl) 2-fluorobenzenecarbothioate?
The canonical SMILES for S-(cyanomethyl) 2-fluorobenzenecarbothioate is N#CCSC(=O)c1ccccc1F.
What is the InChIKey of S-(cyanomethyl) 2-fluorobenzenecarbothioate?
The InChIKey is MCABVAFIVUKINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNOS/c10-8-4-2-1-3-7(8)9(12)13-6-5-11/h1-4H,6H2.
What are the key properties of S-(cyanomethyl) 2-fluorobenzenecarbothioate?
S-(cyanomethyl) 2-fluorobenzenecarbothioate has a molecular weight of 195.22 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(cyanomethyl) 2-fluorobenzenecarbothioate is sourced from PubChem (CID 146534654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).