C16H24N2O6 — CID 146550810
(2R,3R,4E,5S)-5-methoxy-6-methyl-4-[(4-nitrophenyl)methoxyimino]heptane-2,3-diol (PubChem CID 146550810) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2R,3R,4E,5S)-5-methoxy-6-methyl-4-[(4-nitrophenyl)methoxyimino]heptane-2,3-diol.
| Compound Name | (2R,3R,4E,5S)-5-methoxy-6-methyl-4-[(4-nitrophenyl)methoxyimino]heptane-2,3-diol |
|---|---|
| PubChem CID | 146550810 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2R,3R,4E,5S)-5-methoxy-6-methyl-4-[(4-nitrophenyl)methoxyimino]heptane-2,3-diol |
| SMILES | CO[C@H](/C(=N/OCc1ccc([N+](=O)[O-])cc1)[C@@H](O)[C@@H](C)O)C(C)C |
| InChI | InChI=1S/C16H24N2O6/c1-10(2)16(23-4)14(15(20)11(3)19)17-24-9-12-5-7-13(8-6-12)18(21)22/h5-8,10-11,15-16,19-20H,9H2,1-4H3/b17-14+/t11-,15+,16+/m1/s1 |
| InChIKey | IWUVLVCCVJTHNE-XGMOUBLCSA-N |
| XLogP | 1.88 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|