About 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide
2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide (PubChem CID 146555235) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide.
Molecular Properties
| Compound Name | 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide |
| PubChem CID | 146555235 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide |
| SMILES | C=C/C=C\CNC(=O)C(OC)OC |
| InChI | InChI=1S/C9H15NO3/c1-4-5-6-7-10-8(11)9(12-2)13-3/h4-6,9H,1,7H2,2-3H3,(H,10,11)/b6-5- |
| InChIKey | DCZUJYJTTHQWBA-WAYWQWQTSA-N |
| XLogP | 0.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide?
The IUPAC name of 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide (CID 146555235) is 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide.
What is the SMILES notation for 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide?
The canonical SMILES for 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide is C=C/C=C\CNC(=O)C(OC)OC.
What is the InChIKey of 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide?
The InChIKey is DCZUJYJTTHQWBA-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H15NO3/c1-4-5-6-7-10-8(11)9(12-2)13-3/h4-6,9H,1,7H2,2-3H3,(H,10,11)/b6-5-.
What are the key properties of 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide?
2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide has a molecular weight of 185.22 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxy-N-[(2Z)-penta-2,4-dienyl]acetamide is sourced from PubChem (CID 146555235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).