C7H13N3 — CID 146558163
2-[(3Z)-hexa-1,3-dien-2-yl]guanidine (PubChem CID 146558163) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-[(3Z)-hexa-1,3-dien-2-yl]guanidine.
| Compound Name | 2-[(3Z)-hexa-1,3-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 146558163 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-[(3Z)-hexa-1,3-dien-2-yl]guanidine |
| SMILES | C=C(/C=C\CC)N=C(N)N |
| InChI | InChI=1S/C7H13N3/c1-3-4-5-6(2)10-7(8)9/h4-5H,2-3H2,1H3,(H4,8,9,10)/b5-4- |
| InChIKey | XSPYPDQILJNERV-PLNGDYQASA-N |
| XLogP | 0.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|