C10H20F3N3O3 — CID 146561196
tert-butyl N-[[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]amino]-N-methylcarbamate (PubChem CID 146561196) has the molecular formula C10H20F3N3O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is tert-butyl N-[[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]amino]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 146561196 |
| Molecular Formula | C10H20F3N3O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl N-[[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]amino]-N-methylcarbamate |
| SMILES | CN(NCC(O)NCC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20F3N3O3/c1-9(2,3)19-8(18)16(4)15-5-7(17)14-6-10(11,12)13/h7,14-15,17H,5-6H2,1-4H3 |
| InChIKey | CDWDPVWZHKXGQL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|