C10H18F3N3O3 — CID 175503346
tert-butyl N-methyl-N-[[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]amino]carbamate (PubChem CID 175503346) has the molecular formula C10H18F3N3O3 and a molecular weight of 285.27 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]amino]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]amino]carbamate |
|---|---|
| PubChem CID | 175503346 |
| Molecular Formula | C10H18F3N3O3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | tert-butyl N-methyl-N-[[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]amino]carbamate |
| SMILES | CN(NCC(=O)NC(F)C(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18F3N3O3/c1-10(2,3)19-9(18)16(4)14-5-6(17)15-8(13)7(11)12/h7-8,14H,5H2,1-4H3,(H,15,17) |
| InChIKey | JPXASKYDSSKOLK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|