C16H24N2O4S2 — CID 146563209
(2S)-2-[(4-aminophenyl)methoxycarbonyl-methylamino]-3-(tert-butyldisulfanyl)propanoic acid (PubChem CID 146563209) has the molecular formula C16H24N2O4S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S)-2-[(4-aminophenyl)methoxycarbonyl-methylamino]-3-(tert-butyldisulfanyl)propanoic acid.
| Compound Name | (2S)-2-[(4-aminophenyl)methoxycarbonyl-methylamino]-3-(tert-butyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 146563209 |
| Molecular Formula | C16H24N2O4S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2S)-2-[(4-aminophenyl)methoxycarbonyl-methylamino]-3-(tert-butyldisulfanyl)propanoic acid |
| SMILES | CN(C(=O)OCc1ccc(N)cc1)[C@H](CSSC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H24N2O4S2/c1-16(2,3)24-23-10-13(14(19)20)18(4)15(21)22-9-11-5-7-12(17)8-6-11/h5-8,13H,9-10,17H2,1-4H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | CQRCWYXTVHIFPE-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|