C11H9N3S — CID 146576736
4,9-dimethyl-[1,2,5]thiadiazolo[3,4-g]isoquinoline (PubChem CID 146576736) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4,9-dimethyl-[1,2,5]thiadiazolo[3,4-g]isoquinoline.
| Compound Name | 4,9-dimethyl-[1,2,5]thiadiazolo[3,4-g]isoquinoline |
|---|---|
| PubChem CID | 146576736 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4,9-dimethyl-[1,2,5]thiadiazolo[3,4-g]isoquinoline |
| SMILES | Cc1c2ccncc2c(C)c2nsnc12 |
| InChI | InChI=1S/C11H9N3S/c1-6-8-3-4-12-5-9(8)7(2)11-10(6)13-15-14-11/h3-5H,1-2H3 |
| InChIKey | XOIBTHNPTZKIKH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |