C37H52S — CID 146580318
2,4-bis(1-adamantyl)-6-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)benzenethiol (PubChem CID 146580318) has the molecular formula C37H52S and a molecular weight of 528.89 g/mol. Its IUPAC name is 2,4-bis(1-adamantyl)-6-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)benzenethiol.
| Compound Name | 2,4-bis(1-adamantyl)-6-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)benzenethiol |
|---|---|
| PubChem CID | 146580318 |
| Molecular Formula | C37H52S |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 2,4-bis(1-adamantyl)-6-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)benzenethiol |
| SMILES | CC1CC2CC(C1)CC(C)(c1cc(C34CC5CC(CC(C5)C3)C4)cc(C34CC5CC(CC(C5)C3)C4)c1S)C2 |
| InChI | InChI=1S/C37H52S/c1-22-3-23-5-24(4-22)15-35(2,14-23)32-12-31(36-16-25-6-26(17-36)8-27(7-25)18-36)13-33(34(32)38)37-19-28-9-29(20-37)11-30(10-28)21-37/h12-13,22-30,38H,3-11,14-21H2,1-2H3 |
| InChIKey | LBABNNNZSQVKKR-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|