C11H23NO2 — CID 14658342
(E)-N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine (PubChem CID 14658342) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is (E)-N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine.
| Compound Name | (E)-N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 14658342 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (E)-N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine |
| SMILES | CCN(CC)C/C=C(\C)C(OC)OC |
| InChI | InChI=1S/C11H23NO2/c1-6-12(7-2)9-8-10(3)11(13-4)14-5/h8,11H,6-7,9H2,1-5H3/b10-8+ |
| InChIKey | PTDCZNJKKZYCBJ-CSKARUKUSA-N |
| XLogP | 1.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|