C29H37ClN4O8S — CID 146584116
tert-butyl (4S)-4-[[(3R)-3-[(4-chlorophenyl)methyl]-1-(4-nitrophenyl)sulfonylpiperidin-3-yl]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 146584116) has the molecular formula C29H37ClN4O8S and a molecular weight of 637.16 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[(3R)-3-[(4-chlorophenyl)methyl]-1-(4-nitrophenyl)sulfonylpiperidin-3-yl]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[[(3R)-3-[(4-chlorophenyl)methyl]-1-(4-nitrophenyl)sulfonylpiperidin-3-yl]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 146584116 |
| Molecular Formula | C29H37ClN4O8S |
| Molecular Weight | 637.16 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | tert-butyl (4S)-4-[[(3R)-3-[(4-chlorophenyl)methyl]-1-(4-nitrophenyl)sulfonylpiperidin-3-yl]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(=O)N[C@@]2(Cc3ccc(Cl)cc3)CCCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C2)COC1(C)C |
| InChI | InChI=1S/C29H37ClN4O8S/c1-27(2,3)42-26(36)33-24(18-41-28(33,4)5)25(35)31-29(17-20-7-9-21(30)10-8-20)15-6-16-32(19-29)43(39,40)23-13-11-22(12-14-23)34(37)38/h7-14,24H,6,15-19H2,1-5H3,(H,31,35)/t24-,29+/m0/s1 |
| InChIKey | KGRWPPUEBNUQST-PWUYWRBVSA-N |
| XLogP | 4.50 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|