About (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide
(4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide (PubChem CID 146588168) has the molecular formula C7H14INO2S
and a molecular weight of 303.17 g/mol. Its IUPAC name is (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide |
| PubChem CID | 146588168 |
| Molecular Formula | C7H14INO2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide |
| SMILES | CC(C)[C@H]1CCS(=O)(=O)N(I)C1 |
| InChI | InChI=1S/C7H14INO2S/c1-6(2)7-3-4-12(10,11)9(8)5-7/h6-7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | UMZXQKSDHXIWFD-ZETCQYMHSA-N |
| XLogP | 1.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide?
The IUPAC name of (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide (CID 146588168) is (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide.
What is the SMILES notation for (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide?
The canonical SMILES for (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide is CC(C)[C@H]1CCS(=O)(=O)N(I)C1.
What is the InChIKey of (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide?
The InChIKey is UMZXQKSDHXIWFD-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H14INO2S/c1-6(2)7-3-4-12(10,11)9(8)5-7/h6-7H,3-5H2,1-2H3/t7-/m0/s1.
What are the key properties of (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide?
(4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide has a molecular weight of 303.17 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-iodo-4-propan-2-ylthiazinane 1,1-dioxide is sourced from PubChem (CID 146588168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).