C14H22N2O2 — CID 146592606
(3S)-3-pentoxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine (PubChem CID 146592606) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S)-3-pentoxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine.
| Compound Name | (3S)-3-pentoxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine |
|---|---|
| PubChem CID | 146592606 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3S)-3-pentoxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine |
| SMILES | CCCCCO[C@H]1CNc2cc(N)ccc2OC1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-3-4-7-17-12-9-16-13-8-11(15)5-6-14(13)18-10-12/h5-6,8,12,16H,2-4,7,9-10,15H2,1H3/t12-/m0/s1 |
| InChIKey | WLZKVDYSIKDCPB-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|