C33H36F2N8O4 — CID 146598650
3-[4-[1-[2-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 146598650) has the molecular formula C33H36F2N8O4 and a molecular weight of 646.70 g/mol. Its IUPAC name is 3-[4-[1-[2-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[2-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146598650 |
| Molecular Formula | C33H36F2N8O4 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 3-[4-[1-[2-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(-c3ccc4c(cnn4CCOCC4CCC(n5cc(N)c(C(F)F)n5)CC4)c3)c21 |
| InChI | InChI=1S/C33H36F2N8O4/c1-40-30-23(3-2-4-26(30)43(33(40)46)27-11-12-28(44)38-32(27)45)20-7-10-25-21(15-20)16-37-41(25)13-14-47-18-19-5-8-22(9-6-19)42-17-24(36)29(39-42)31(34)35/h2-4,7,10,15-17,19,22,27,31H,5-6,8-9,11-14,18,36H2,1H3,(H,38,44,45) |
| InChIKey | RKYNYHHGLWKEMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|