C29H24F2N4O4S — CID 146607316
(2E,4Z)-2-[(3,4-difluorophenyl)methyl]-5-formamido-N-[3-oxo-3-[[(3Z)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]amino]propyl]penta-2,4-dienamide (PubChem CID 146607316) has the molecular formula C29H24F2N4O4S and a molecular weight of 562.60 g/mol. Its IUPAC name is (2E,4Z)-2-[(3,4-difluorophenyl)methyl]-5-formamido-N-[3-oxo-3-[[(3Z)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]amino]propyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-2-[(3,4-difluorophenyl)methyl]-5-formamido-N-[3-oxo-3-[[(3Z)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]amino]propyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 146607316 |
| Molecular Formula | C29H24F2N4O4S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (2E,4Z)-2-[(3,4-difluorophenyl)methyl]-5-formamido-N-[3-oxo-3-[[(3Z)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]amino]propyl]penta-2,4-dienamide |
| SMILES | O=CN/C=C\C=C(/Cc1ccc(F)c(F)c1)C(=O)NCCC(=O)Nc1ccc2c(c1)/C(=C/c1cccs1)C(=O)N2 |
| InChI | InChI=1S/C29H24F2N4O4S/c30-24-7-5-18(14-25(24)31)13-19(3-1-10-32-17-36)28(38)33-11-9-27(37)34-20-6-8-26-22(15-20)23(29(39)35-26)16-21-4-2-12-40-21/h1-8,10,12,14-17H,9,11,13H2,(H,32,36)(H,33,38)(H,34,37)(H,35,39)/b10-1-,19-3+,23-16- |
| InChIKey | GQHMBBMNUSMTRP-XKPLQFRYSA-N |
| XLogP | 4.39 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|