About 3,4-di(propan-2-yl)-1,3-oxazinane
3,4-di(propan-2-yl)-1,3-oxazinane (PubChem CID 146614615) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 3,4-di(propan-2-yl)-1,3-oxazinane |
| PubChem CID | 146614615 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,3-oxazinane |
| SMILES | CC(C)C1CCOCN1C(C)C |
| InChI | InChI=1S/C10H21NO/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-10H,5-7H2,1-4H3 |
| InChIKey | HYCBQVDPKOEHKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-di(propan-2-yl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-di(propan-2-yl)-1,3-oxazinane?
The IUPAC name of 3,4-di(propan-2-yl)-1,3-oxazinane (CID 146614615) is 3,4-di(propan-2-yl)-1,3-oxazinane.
What is the SMILES notation for 3,4-di(propan-2-yl)-1,3-oxazinane?
The canonical SMILES for 3,4-di(propan-2-yl)-1,3-oxazinane is CC(C)C1CCOCN1C(C)C.
What is the InChIKey of 3,4-di(propan-2-yl)-1,3-oxazinane?
The InChIKey is HYCBQVDPKOEHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-10H,5-7H2,1-4H3.
What are the key properties of 3,4-di(propan-2-yl)-1,3-oxazinane?
3,4-di(propan-2-yl)-1,3-oxazinane has a molecular weight of 171.28 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-di(propan-2-yl)-1,3-oxazinane is sourced from PubChem (CID 146614615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).