C9H22N2O3S — CID 146627108
(2S)-2-amino-3-methylbutanoic acid;2-methylpropane-2-sulfinamide (PubChem CID 146627108) has the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;2-methylpropane-2-sulfinamide.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 146627108 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(N)=O.CC(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2.C4H11NOS/c1-3(2)4(6)5(7)8;1-4(2,3)7(5)6/h3-4H,6H2,1-2H3,(H,7,8);5H2,1-3H3/t4-;/m0./s1 |
| InChIKey | ZJJQOIVVOFZCSR-WCCKRBBISA-N |
| XLogP | 0.46 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |