C17H23NO9S2 — CID 146633490
1-O-benzyl 2-O-methylsulfonyl (2R,3S)-3-methyl-2-(2-methylsulfonyloxyethyl)azetidine-1,2-dicarboxylate (PubChem CID 146633490) has the molecular formula C17H23NO9S2 and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methylsulfonyl (2R,3S)-3-methyl-2-(2-methylsulfonyloxyethyl)azetidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methylsulfonyl (2R,3S)-3-methyl-2-(2-methylsulfonyloxyethyl)azetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 146633490 |
| Molecular Formula | C17H23NO9S2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 1-O-benzyl 2-O-methylsulfonyl (2R,3S)-3-methyl-2-(2-methylsulfonyloxyethyl)azetidine-1,2-dicarboxylate |
| SMILES | C[C@H]1CN(C(=O)OCc2ccccc2)[C@@]1(CCOS(C)(=O)=O)C(=O)OS(C)(=O)=O |
| InChI | InChI=1S/C17H23NO9S2/c1-13-11-18(16(20)25-12-14-7-5-4-6-8-14)17(13,9-10-26-28(2,21)22)15(19)27-29(3,23)24/h4-8,13H,9-12H2,1-3H3/t13-,17+/m0/s1 |
| InChIKey | GTHZBIJEWNYHEP-SUMWQHHRSA-N |
| XLogP | 0.88 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|