C20H26N4O — CID 146637261
1-N-(3-methyl-1-adamantyl)-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diamine (PubChem CID 146637261) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-N-(3-methyl-1-adamantyl)-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diamine.
| Compound Name | 1-N-(3-methyl-1-adamantyl)-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 146637261 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-N-(3-methyl-1-adamantyl)-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diamine |
| SMILES | Cc1noc(-c2ccc(NC34CC5CC(CC(C)(C5)C3)C4)c(N)c2)n1 |
| InChI | InChI=1S/C20H26N4O/c1-12-22-18(25-24-12)15-3-4-17(16(21)6-15)23-20-9-13-5-14(10-20)8-19(2,7-13)11-20/h3-4,6,13-14,23H,5,7-11,21H2,1-2H3 |
| InChIKey | RBCKIAWBXRWXBI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|