C17H27N — CID 146637346
7-(3-ethylhexyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 146637346) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 7-(3-ethylhexyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(3-ethylhexyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 146637346 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 7-(3-ethylhexyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCC(CC)CCc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C17H27N/c1-3-6-14(4-2)8-9-15-10-11-16-7-5-12-18-17(16)13-15/h10-11,13-14,18H,3-9,12H2,1-2H3 |
| InChIKey | ROYGMCMNIQGVIL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |