C10H17N — CID 146639074
N,4-dimethyl-N-prop-1-en-2-ylpenta-1,4-dien-2-amine (PubChem CID 146639074) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N,4-dimethyl-N-prop-1-en-2-ylpenta-1,4-dien-2-amine.
| Compound Name | N,4-dimethyl-N-prop-1-en-2-ylpenta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 146639074 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N,4-dimethyl-N-prop-1-en-2-ylpenta-1,4-dien-2-amine |
| SMILES | C=C(C)CC(=C)N(C)C(=C)C |
| InChI | InChI=1S/C10H17N/c1-8(2)7-10(5)11(6)9(3)4/h1,3,5,7H2,2,4,6H3 |
| InChIKey | YIOJOTWVPQLLFC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|