C22H34N6O — CID 146641575
N-[3-(methylamino)propyl]-1-propyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 146641575) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-1-propyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[3-(methylamino)propyl]-1-propyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 146641575 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N-[3-(methylamino)propyl]-1-propyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCCn1nc(C(=O)NCCCNC)c2c1CCC(NCCc1ccncc1)C2 |
| InChI | InChI=1S/C22H34N6O/c1-3-15-28-20-6-5-18(25-14-9-17-7-12-24-13-8-17)16-19(20)21(27-28)22(29)26-11-4-10-23-2/h7-8,12-13,18,23,25H,3-6,9-11,14-16H2,1-2H3,(H,26,29) |
| InChIKey | CKHKPBYACDEUBW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|