C16H20N4O — CID 146642120
1-(3-bicyclo[3.2.1]octanyl)-3-(1H-pyrrolo[3,2-c]pyridin-3-yl)urea (PubChem CID 146642120) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(3-bicyclo[3.2.1]octanyl)-3-(1H-pyrrolo[3,2-c]pyridin-3-yl)urea.
| Compound Name | 1-(3-bicyclo[3.2.1]octanyl)-3-(1H-pyrrolo[3,2-c]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 146642120 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(3-bicyclo[3.2.1]octanyl)-3-(1H-pyrrolo[3,2-c]pyridin-3-yl)urea |
| SMILES | O=C(Nc1c[nH]c2ccncc12)NC1CC2CCC(C2)C1 |
| InChI | InChI=1S/C16H20N4O/c21-16(19-12-6-10-1-2-11(5-10)7-12)20-15-9-18-14-3-4-17-8-13(14)15/h3-4,8-12,18H,1-2,5-7H2,(H2,19,20,21) |
| InChIKey | DTBFWEUZGNFUQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |