C19H21N5O — CID 146642168
1-(5-cyclohexyl-2-pyridinyl)-3-(1H-pyrrolo[2,3-c]pyridin-3-yl)urea (PubChem CID 146642168) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2-pyridinyl)-3-(1H-pyrrolo[2,3-c]pyridin-3-yl)urea.
| Compound Name | 1-(5-cyclohexyl-2-pyridinyl)-3-(1H-pyrrolo[2,3-c]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 146642168 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-(5-cyclohexyl-2-pyridinyl)-3-(1H-pyrrolo[2,3-c]pyridin-3-yl)urea |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cn1)Nc1c[nH]c2cnccc12 |
| InChI | InChI=1S/C19H21N5O/c25-19(23-17-12-21-16-11-20-9-8-15(16)17)24-18-7-6-14(10-22-18)13-4-2-1-3-5-13/h6-13,21H,1-5H2,(H2,22,23,24,25) |
| InChIKey | FKXPOSYJFAGXHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |