C26H23ClFN5O2 — CID 146653469
4-[[4-[5-chloro-6-(3-ethoxypropylamino)-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile (PubChem CID 146653469) has the molecular formula C26H23ClFN5O2 and a molecular weight of 491.95 g/mol. Its IUPAC name is 4-[[4-[5-chloro-6-(3-ethoxypropylamino)-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[5-chloro-6-(3-ethoxypropylamino)-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146653469 |
| Molecular Formula | C26H23ClFN5O2 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 4-[[4-[5-chloro-6-(3-ethoxypropylamino)-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
| SMILES | CCOCCCNc1nc(F)c(-c2nn(Cc3ccc(C#N)cc3)c(=O)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C26H23ClFN5O2/c1-2-35-13-5-12-30-25-22(27)14-21(24(28)31-25)23-19-6-3-4-7-20(19)26(34)33(32-23)16-18-10-8-17(15-29)9-11-18/h3-4,6-11,14H,2,5,12-13,16H2,1H3,(H,30,31) |
| InChIKey | YKBNYDMCPZAKBD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|