C28H22FN3O7 — CID 146657184
(6S,6aR,7aS,8S,11aR)-8-amino-6-(4-fluorophenyl)-11,11a,13,14-tetrahydroxy-9,12-dioxo-6a,7,7a,8-tetrahydro-6H-anthra[2,3-g]quinoline-10-carboxamide (PubChem CID 146657184) has the molecular formula C28H22FN3O7 and a molecular weight of 531.50 g/mol. Its IUPAC name is (6S,6aR,7aS,8S,11aR)-8-amino-6-(4-fluorophenyl)-11,11a,13,14-tetrahydroxy-9,12-dioxo-6a,7,7a,8-tetrahydro-6H-anthra[2,3-g]quinoline-10-carboxamide.
| Compound Name | (6S,6aR,7aS,8S,11aR)-8-amino-6-(4-fluorophenyl)-11,11a,13,14-tetrahydroxy-9,12-dioxo-6a,7,7a,8-tetrahydro-6H-anthra[2,3-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 146657184 |
| Molecular Formula | C28H22FN3O7 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | (6S,6aR,7aS,8S,11aR)-8-amino-6-(4-fluorophenyl)-11,11a,13,14-tetrahydroxy-9,12-dioxo-6a,7,7a,8-tetrahydro-6H-anthra[2,3-g]quinoline-10-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5cccnc5c4O)[C@H](c4ccc(F)cc4)[C@H]3C[C@H]2[C@H](N)C1=O |
| InChI | InChI=1S/C28H22FN3O7/c29-12-5-3-10(4-6-12)16-13-8-11-2-1-7-32-21(11)24(35)17(13)22(33)18-14(16)9-15-20(30)23(34)19(27(31)38)26(37)28(15,39)25(18)36/h1-8,14-16,20,33,35,37,39H,9,30H2,(H2,31,38)/t14-,15+,16+,20+,28+/m1/s1 |
| InChIKey | CZTSGPYHDDEOEK-DZQUNTCHSA-N |
| XLogP | 1.64 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|