C22H27N9 — CID 146657706
N-[(1-benzyltetrazol-5-yl)-(1-tert-butyltetrazol-5-yl)methyl]-2-phenylethanamine (PubChem CID 146657706) has the molecular formula C22H27N9 and a molecular weight of 417.52 g/mol. Its IUPAC name is N-[(1-benzyltetrazol-5-yl)-(1-tert-butyltetrazol-5-yl)methyl]-2-phenylethanamine.
| Compound Name | N-[(1-benzyltetrazol-5-yl)-(1-tert-butyltetrazol-5-yl)methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 146657706 |
| Molecular Formula | C22H27N9 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[(1-benzyltetrazol-5-yl)-(1-tert-butyltetrazol-5-yl)methyl]-2-phenylethanamine |
| SMILES | CC(C)(C)n1nnnc1C(NCCc1ccccc1)c1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C22H27N9/c1-22(2,3)31-21(25-27-29-31)19(23-15-14-17-10-6-4-7-11-17)20-24-26-28-30(20)16-18-12-8-5-9-13-18/h4-13,19,23H,14-16H2,1-3H3 |
| InChIKey | MULLWYSGBPWQDF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |