C18H26N4O2 — CID 118499914
(2S)-2-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-phenylethyl]pentanoic acid (PubChem CID 118499914) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-phenylethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-phenylethyl]pentanoic acid |
|---|---|
| PubChem CID | 118499914 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (2S)-2-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-phenylethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccccc1)c1nnnn1C(C)(C)C |
| InChI | InChI=1S/C18H26N4O2/c1-5-9-14(17(23)24)15(12-13-10-7-6-8-11-13)16-19-20-21-22(16)18(2,3)4/h6-8,10-11,14-15H,5,9,12H2,1-4H3,(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | UWRRYJNJHOSHRE-GJZGRUSLSA-N |
| XLogP | 3.26 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |