C19H30BrN5O3Si — CID 140792446
(2S)-2-[(1S)-2-(6-bromo-3-pyridinyl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid (PubChem CID 140792446) has the molecular formula C19H30BrN5O3Si and a molecular weight of 484.47 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-(6-bromo-3-pyridinyl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-(6-bromo-3-pyridinyl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 140792446 |
| Molecular Formula | C19H30BrN5O3Si |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (2S)-2-[(1S)-2-(6-bromo-3-pyridinyl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)[C@H](Cc1ccc(Br)nc1)c1nnnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H30BrN5O3Si/c1-5-6-15(19(26)27)16(11-14-7-8-17(20)21-12-14)18-22-23-24-25(18)13-28-9-10-29(2,3)4/h7-8,12,15-16H,5-6,9-11,13H2,1-4H3,(H,26,27)/t15?,16-/m0/s1 |
| InChIKey | QYUUVFPJAWSNRP-LYKKTTPLSA-N |
| XLogP | 3.97 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|