C20H31F3N6O4Si — CID 140792453
(2S)-2-[(1S)-2-[6-(2-aminoethoxy)-3-pyridinyl]-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]-4,4,4-trifluorobutanoic acid (PubChem CID 140792453) has the molecular formula C20H31F3N6O4Si and a molecular weight of 504.59 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[6-(2-aminoethoxy)-3-pyridinyl]-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]-4,4,4-trifluorobutanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[6-(2-aminoethoxy)-3-pyridinyl]-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 140792453 |
| Molecular Formula | C20H31F3N6O4Si |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (2S)-2-[(1S)-2-[6-(2-aminoethoxy)-3-pyridinyl]-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]-4,4,4-trifluorobutanoic acid |
| SMILES | C[Si](C)(C)CCOCn1nnnc1[C@@H](Cc1ccc(OCCN)nc1)[C@H](CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H31F3N6O4Si/c1-34(2,3)9-8-32-13-29-18(26-27-28-29)15(16(19(30)31)11-20(21,22)23)10-14-4-5-17(25-12-14)33-7-6-24/h4-5,12,15-16H,6-11,13,24H2,1-3H3,(H,30,31)/t15-,16-/m0/s1 |
| InChIKey | DMUJZROOVOVJKK-HOTGVXAUSA-N |
| XLogP | 2.70 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|