C19H26IN7OSi — CID 86604693
6-iodo-N-[2-phenyl-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pyrimidin-4-amine (PubChem CID 86604693) has the molecular formula C19H26IN7OSi and a molecular weight of 523.46 g/mol. Its IUPAC name is 6-iodo-N-[2-phenyl-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-iodo-N-[2-phenyl-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86604693 |
| Molecular Formula | C19H26IN7OSi |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 6-iodo-N-[2-phenyl-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1nnnc1C(Cc1ccccc1)Nc1cc(I)ncn1 |
| InChI | InChI=1S/C19H26IN7OSi/c1-29(2,3)10-9-28-14-27-19(24-25-26-27)16(11-15-7-5-4-6-8-15)23-18-12-17(20)21-13-22-18/h4-8,12-13,16H,9-11,14H2,1-3H3,(H,21,22,23) |
| InChIKey | VVCRRRYJVLKZKM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|