C18H29BrN4O3SSi — CID 140792493
(2S)-2-[(1S)-2-(5-bromothiophen-2-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid (PubChem CID 140792493) has the molecular formula C18H29BrN4O3SSi and a molecular weight of 489.51 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-(5-bromothiophen-2-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-(5-bromothiophen-2-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 140792493 |
| Molecular Formula | C18H29BrN4O3SSi |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (2S)-2-[(1S)-2-(5-bromothiophen-2-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccc(Br)s1)c1nnnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H29BrN4O3SSi/c1-5-6-14(18(24)25)15(11-13-7-8-16(19)27-13)17-20-21-22-23(17)12-26-9-10-28(2,3)4/h7-8,14-15H,5-6,9-12H2,1-4H3,(H,24,25)/t14-,15-/m0/s1 |
| InChIKey | BHKCGFMFLVMSFA-GJZGRUSLSA-N |
| XLogP | 4.64 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|