C24H25NO9 — CID 146658283
[(1R,2S,5R)-5-hydroxy-2,5,7-trimethyl-1-(4-nitrophenoxy)carbonyloxy-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate (PubChem CID 146658283) has the molecular formula C24H25NO9 and a molecular weight of 471.46 g/mol. Its IUPAC name is [(1R,2S,5R)-5-hydroxy-2,5,7-trimethyl-1-(4-nitrophenoxy)carbonyloxy-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate.
| Compound Name | [(1R,2S,5R)-5-hydroxy-2,5,7-trimethyl-1-(4-nitrophenoxy)carbonyloxy-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146658283 |
| Molecular Formula | C24H25NO9 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [(1R,2S,5R)-5-hydroxy-2,5,7-trimethyl-1-(4-nitrophenoxy)carbonyloxy-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)C=C2C(=O)[C@](C)(O)C3(CC3)C(C)=C2[C@H]1OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25NO9/c1-13-18-17(19(27)23(4,29)24(13)9-10-24)11-22(3,12-32-14(2)26)20(18)34-21(28)33-16-7-5-15(6-8-16)25(30)31/h5-8,11,20,29H,9-10,12H2,1-4H3/t20-,22+,23+/m1/s1 |
| InChIKey | WBDSFMDXEWFDGL-PUHATCMVSA-N |
| XLogP | 3.42 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|