C24H25NO7 — CID 46179705
3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl (4-nitrophenyl) carbonate (PubChem CID 46179705) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl (4-nitrophenyl) carbonate.
| Compound Name | 3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 46179705 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl (4-nitrophenyl) carbonate |
| SMILES | CC1=C(CCCOC(=O)Oc2ccc([N+](=O)[O-])cc2)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C24H25NO7/c1-14-13-19-20(15(2)24(10-11-24)23(3,28)21(19)26)18(14)5-4-12-31-22(27)32-17-8-6-16(7-9-17)25(29)30/h6-9,13,28H,4-5,10-12H2,1-3H3/t23-/m0/s1 |
| InChIKey | SNOGSUYGOILCPP-QHCPKHFHSA-N |
| XLogP | 4.58 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|